cas: 84460-89-9 — see every product listed under this CAS number, including other names
N-(2-Aminoethyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide 98% (CAS 84460-89-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A395590-100mg |
| cas | 84460-89-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1143.56 Pln | |
| Ambeed | 5g | 3134.94 Pln | |
| Ambeed | 10g | 4992.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A395590 |
N-(2-aminoethyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide (CAS 84460-89-9) is a chemical compound with the molecular formula C13H18N2O and a molecular weight of 218.29 g/mol. IUPAC name: N-(2-aminoethyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide. InChIKey: ASNYEBSCXSIDAC-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | N-(2-aminoethyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
| InChIKey | ASNYEBSCXSIDAC-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C1)C(=O)NCCN |
Computed by PubChem (NCBI)