cas: 216700-84-4 — see every product listed under this CAS number, including other names
N-(2-Aminophenyl)-4-fluorobenzene-1-sulfonamide, 97%, 97% (CAS 216700-84-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120H4E-100mg |
| cas | 216700-84-4 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 2498.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-(2-aminophenyl)-4-fluorobenzenesulfonamide (CAS 216700-84-4) is a chemical compound with the molecular formula C12H11FN2O2S and a molecular weight of 266.29 g/mol. IUPAC name: N-(2-aminophenyl)-4-fluorobenzenesulfonamide. InChIKey: JNMXTMNGVYNSPE-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O2S |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | N-(2-aminophenyl)-4-fluorobenzenesulfonamide |
| InChIKey | JNMXTMNGVYNSPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NS(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)