CAS 74476-50-9 is the registry number for Ethyl 2-amino-4-(4-fluorophenyl)thiazole-5-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 2-amino-4-(4-fluorophenyl)-1,3-thiazole-5-carboxylate (CAS 74476-50-9) is a chemical compound with the molecular formula C12H11FN2O2S and a molecular weight of 266.29 g/mol. IUPAC name: ethyl 2-amino-4-(4-fluorophenyl)-1,3-thiazole-5-carboxylate. InChIKey: LLLSBBDKXRRZAU-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O2S |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | ethyl 2-amino-4-(4-fluorophenyl)-1,3-thiazole-5-carboxylate |
| InChIKey | LLLSBBDKXRRZAU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)