cas: 2903-37-9 — see every product listed under this CAS number, including other names
N-(2-Chloro-4-methylphenyl)-4-methylbenzenesulfonamide, 98%, 98% (CAS 2903-37-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120ERY-1g |
| cas | 2903-37-9 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2013.20 Pln | |
| Chemat | 5g | 8834.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(2-chloro-4-methylphenyl)-4-methylbenzenesulfonamide (CAS 2903-37-9) is a chemical compound with the molecular formula C14H14ClNO2S and a molecular weight of 295.8 g/mol. IUPAC name: N-(2-chloro-4-methylphenyl)-4-methylbenzenesulfonamide. InChIKey: RCQMCSRFEXHYPC-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2S |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | N-(2-chloro-4-methylphenyl)-4-methylbenzenesulfonamide |
| InChIKey | RCQMCSRFEXHYPC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=C(C=C2)C)Cl |
Computed by PubChem (NCBI)