CAS 55816-01-8 appears in our catalog under these names: N-(5-Chloro-2-methyl-phenyl)-4-methyl-benzenesulfonamide, 95%, N–(5–Chloro–2–methylphenyl)–4–methylbenzenesulfonamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
N-(5-chloro-2-methylphenyl)-4-methylbenzenesulfonamide (CAS 55816-01-8) is a chemical compound with the molecular formula C14H14ClNO2S and a molecular weight of 295.8 g/mol. IUPAC name: N-(5-chloro-2-methylphenyl)-4-methylbenzenesulfonamide. InChIKey: DKZNFOUXEXTWDY-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2S |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | N-(5-chloro-2-methylphenyl)-4-methylbenzenesulfonamide |
| InChIKey | DKZNFOUXEXTWDY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=CC(=C2)Cl)C |
Computed by PubChem (NCBI)