cas: 6331-00-6 — see every product listed under this CAS number, including other names
N-(2-Chloroethyl)-4-methylbenzenesulfonamide 97% (CAS 6331-00-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A511084-100mg |
| cas | 6331-00-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 854.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A511084 |
N-(2-chloroethyl)-4-methylbenzenesulfonamide (CAS 6331-00-6) is a chemical compound with the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. IUPAC name: N-(2-chloroethyl)-4-methylbenzenesulfonamide. InChIKey: KQWQFEKDXWRGMD-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2S |
|---|---|
| Molecular weight | 233.72 g/mol |
| IUPAC name | N-(2-chloroethyl)-4-methylbenzenesulfonamide |
| InChIKey | KQWQFEKDXWRGMD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCCCl |
Computed by PubChem (NCBI)