CAS 111228-43-4 is the registry number for 3-Chloro-n,n,4-trimethylbenzene-1-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-N,N,4-trimethylbenzenesulfonamide (CAS 111228-43-4) is a chemical compound with the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. IUPAC name: 3-chloro-N,N,4-trimethylbenzenesulfonamide. InChIKey: DAUSLMQPEXARSH-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2S |
|---|---|
| Molecular weight | 233.72 g/mol |
| IUPAC name | 3-chloro-N,N,4-trimethylbenzenesulfonamide |
| InChIKey | DAUSLMQPEXARSH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)N(C)C)Cl |
Computed by PubChem (NCBI)