cas: 35580-76-8 — see every product listed under this CAS number, including other names
N-(2-Chlorophenyl)hydrazinecarboxamide 95+% (CAS 35580-76-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A474994-250mg |
| cas | 35580-76-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 720.81 Pln | |
| Ambeed | 1g | 1694.25 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A474994 |
1-amino-3-(2-chlorophenyl)urea (CAS 35580-76-8) is a chemical compound with the molecular formula C7H8ClN3O and a molecular weight of 185.61 g/mol. IUPAC name: 1-amino-3-(2-chlorophenyl)urea. InChIKey: GCGJAIHYYAKDOJ-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 1-amino-3-(2-chlorophenyl)urea |
| InChIKey | GCGJAIHYYAKDOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)NN)Cl |
Computed by PubChem (NCBI)