cas: 35580-76-8 — see every product listed under this CAS number, including other names
N-(2-Chlorophenyl)hydrazinecarboxamide, 95+%, 95+% (CAS 35580-76-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C9ZI-250mg |
| cas | 35580-76-8 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 549.20 Pln | |
| Chemat | 1g | 1038.80 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
1-amino-3-(2-chlorophenyl)urea (CAS 35580-76-8) is a chemical compound with the molecular formula C7H8ClN3O and a molecular weight of 185.61 g/mol. IUPAC name: 1-amino-3-(2-chlorophenyl)urea. InChIKey: GCGJAIHYYAKDOJ-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 1-amino-3-(2-chlorophenyl)urea |
| InChIKey | GCGJAIHYYAKDOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)NN)Cl |
Computed by PubChem (NCBI)