CAS 775351-59-2 is the registry number for N-(2-cyanoethyl)-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg.
N-(2-cyanoethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 775351-59-2) is a chemical compound with the molecular formula C16H21BN2O3 and a molecular weight of 300.2 g/mol. IUPAC name: N-(2-cyanoethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: OHCFJIQYAPNPAM-UHFFFAOYSA-N.
| Molecular formula | C16H21BN2O3 |
|---|---|
| Molecular weight | 300.2 g/mol |
| IUPAC name | N-(2-cyanoethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | OHCFJIQYAPNPAM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)NCCC#N |
Computed by PubChem (NCBI)