CAS 2173069-28-6 is the registry number for 2-(Methoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(methoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline (CAS 2173069-28-6) is a chemical compound with the molecular formula C16H21BN2O3 and a molecular weight of 300.2 g/mol. IUPAC name: 2-(methoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline. InChIKey: BHVWECUKGOXIHD-UHFFFAOYSA-N.
| Molecular formula | C16H21BN2O3 |
|---|---|
| Molecular weight | 300.2 g/mol |
| IUPAC name | 2-(methoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline |
| InChIKey | BHVWECUKGOXIHD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)N=C(C=N3)COC |
Computed by PubChem (NCBI)