cas: 1256360-45-8 — see every product listed under this CAS number, including other names
N-(2-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)cyclohexanamine 96% (CAS 1256360-45-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A250566-250mg |
| cas | 1256360-45-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 909.94 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A250566 |
N-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclohexanamine (CAS 1256360-45-8) is a chemical compound with the molecular formula C19H29BFNO2 and a molecular weight of 333.3 g/mol. IUPAC name: N-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclohexanamine. InChIKey: YVTNLXMDMUUITG-UHFFFAOYSA-N.
| Molecular formula | C19H29BFNO2 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | N-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclohexanamine |
| InChIKey | YVTNLXMDMUUITG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)CNC3CCCCC3)F |
Computed by PubChem (NCBI)