cas: 874299-08-8 — see every product listed under this CAS number, including other names
N-(2-Methylpropyl)-N′-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea, 95%, 95% (CAS 874299-08-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IEKP-250mg |
| cas | 874299-08-8 |
| size | 250mg |
| availability | 6.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5574.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(2-methylpropyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 874299-08-8) is a chemical compound with the molecular formula C17H27BN2O3 and a molecular weight of 318.2 g/mol. IUPAC name: 1-(2-methylpropyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: NZUAGZUVXVGWLY-UHFFFAOYSA-N.
| Molecular formula | C17H27BN2O3 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | 1-(2-methylpropyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | NZUAGZUVXVGWLY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)NCC(C)C |
Computed by PubChem (NCBI)