cas: 2246765-36-4 — see every product listed under this CAS number, including other names
N-(2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-2,2-dimethylbutanamide, 95%, 95% (CAS 2246765-36-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FTMX-100mg |
| cas | 2246765-36-4 |
| size | 100mg |
| availability | 1.8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1994.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-dimethylbutanamide (CAS 2246765-36-4) is a chemical compound with the molecular formula C19H30BNO4 and a molecular weight of 347.3 g/mol. IUPAC name: N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-dimethylbutanamide. InChIKey: JASMMJCQXCSRDY-UHFFFAOYSA-N.
| Molecular formula | C19H30BNO4 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-dimethylbutanamide |
| InChIKey | JASMMJCQXCSRDY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NC(=O)C(C)(C)CC)OC |
Computed by PubChem (NCBI)