CAS 1430471-81-0 is the registry number for 3-Methoxy-4-(N-methylpiperidin-4-yloxy)phenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
4-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1-methylpiperidine (CAS 1430471-81-0) is a chemical compound with the molecular formula C19H30BNO4 and a molecular weight of 347.3 g/mol. IUPAC name: 4-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1-methylpiperidine. InChIKey: BYPGDPVUHPIIDK-UHFFFAOYSA-N.
| Molecular formula | C19H30BNO4 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | 4-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1-methylpiperidine |
| InChIKey | BYPGDPVUHPIIDK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC3CCN(CC3)C)OC |
Computed by PubChem (NCBI)