cas: 1914078-78-6 — see every product listed under this CAS number, including other names
N-(2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-3,3-dimethylbutanamide, 95%, 95% (CAS 1914078-78-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FU8G-100mg |
| cas | 1914078-78-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,3-dimethylbutanamide (CAS 1914078-78-6) is a chemical compound with the molecular formula C19H30BNO4 and a molecular weight of 347.3 g/mol. IUPAC name: N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,3-dimethylbutanamide. InChIKey: JBCCPZSOLHEHMC-UHFFFAOYSA-N.
| Molecular formula | C19H30BNO4 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,3-dimethylbutanamide |
| InChIKey | JBCCPZSOLHEHMC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NC(=O)CC(C)(C)C)OC |
Computed by PubChem (NCBI)