cas: 2245819-88-7 — see every product listed under this CAS number, including other names
N-(2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)propane-1-sulfonamide, 95%, 95% (CAS 2245819-88-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FTN2-100mg |
| cas | 2245819-88-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1614.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide (CAS 2245819-88-7) is a chemical compound with the molecular formula C16H26BNO5S and a molecular weight of 355.3 g/mol. IUPAC name: N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide. InChIKey: OYUBSUCMLYQJFR-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO5S |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide |
| InChIKey | OYUBSUCMLYQJFR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NS(=O)(=O)CCC)OC |
Computed by PubChem (NCBI)