cas: 874299-01-1 — see every product listed under this CAS number, including other names
N-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperidine-1-carboxamide 95% (CAS 874299-01-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A312048-250mg |
| cas | 874299-01-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 954.44 Pln | |
| Ambeed | 5g | 4392.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A312048 |
N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxamide (CAS 874299-01-1) is a chemical compound with the molecular formula C18H27BN2O3 and a molecular weight of 330.2 g/mol. IUPAC name: N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxamide. InChIKey: LDEPAKFSPUQKCJ-UHFFFAOYSA-N.
| Molecular formula | C18H27BN2O3 |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxamide |
| InChIKey | LDEPAKFSPUQKCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)N3CCCCC3 |
Computed by PubChem (NCBI)