cas: 2155834-10-7 — see every product listed under this CAS number, including other names
N-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)propane-2-sulfonamide, 98% (CAS 2155834-10-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1356792-5g |
| cas | 2155834-10-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11390.89 Pln | |
| Fluorochem | 100mg | 607.10 Pln | |
| Fluorochem | 250mg | 1002.79 Pln | |
| Fluorochem | 1g | 1965.99 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-2-sulfonamide (CAS 2155834-10-7) is a chemical compound with the molecular formula C15H24BNO4S and a molecular weight of 325.2 g/mol. IUPAC name: N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-2-sulfonamide. InChIKey: VYWHWUAJVRXRCW-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO4S |
|---|---|
| Molecular weight | 325.2 g/mol |
| IUPAC name | N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-2-sulfonamide |
| InChIKey | VYWHWUAJVRXRCW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NS(=O)(=O)C(C)C |
Computed by PubChem (NCBI)