CAS 2377608-59-6 is the registry number for N-Propyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
N-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (CAS 2377608-59-6) is a chemical compound with the molecular formula C15H24BNO4S and a molecular weight of 325.2 g/mol. IUPAC name: N-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide. InChIKey: URPCRQBRTIKFHJ-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO4S |
|---|---|
| Molecular weight | 325.2 g/mol |
| IUPAC name | N-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| InChIKey | URPCRQBRTIKFHJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)NCCC |
Computed by PubChem (NCBI)