cas: 667-84-5 — see every product listed under this CAS number, including other names
N-(3-Ethoxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide 97% (CAS 667-84-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A411288-100mg |
| cas | 667-84-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 854.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A411288 |
N-(3-ethoxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide (CAS 667-84-5) is a chemical compound with the molecular formula C11H23NO4 and a molecular weight of 233.30 g/mol. IUPAC name: N-(3-ethoxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide. InChIKey: MRAMPOPITCOOIN-UHFFFAOYSA-N.
| Molecular formula | C11H23NO4 |
|---|---|
| Molecular weight | 233.30 g/mol |
| IUPAC name | N-(3-ethoxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide |
| InChIKey | MRAMPOPITCOOIN-UHFFFAOYSA-N |
| SMILES | CCOCCCNC(=O)C(C(C)(C)CO)O |
Computed by PubChem (NCBI)