CAS 667-84-5 appears in our catalog under these names: Dl-pantothenyl ethyl ether, 97%, DL-Ethyl Panthenol, DL-Ethyl-panthenol, DL-Pantothenyl ethyl ether, 97%, 97%, N-(3-Ethoxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide, 97%. Offered by: Combi-blocks, Chemat Brand, TRC, Chemat, Ambeed. Available pack sizes: 5g, 1g, 250mg, on request, 10g, 100mg.
N-(3-ethoxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide (CAS 667-84-5) is a chemical compound with the molecular formula C11H23NO4 and a molecular weight of 233.30 g/mol. IUPAC name: N-(3-ethoxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide. InChIKey: MRAMPOPITCOOIN-UHFFFAOYSA-N.
| Molecular formula | C11H23NO4 |
|---|---|
| Molecular weight | 233.30 g/mol |
| IUPAC name | N-(3-ethoxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide |
| InChIKey | MRAMPOPITCOOIN-UHFFFAOYSA-N |
| SMILES | CCOCCCNC(=O)C(C(C)(C)CO)O |
Computed by PubChem (NCBI)