cas: 1197193-08-0 — see every product listed under this CAS number, including other names
N-(3-Methylsulphonyl-4-nitrophenyl)piperazine, >95%, >95% (CAS 1197193-08-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PJ7-100mg |
| cas | 1197193-08-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2018.00 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
1-(3-methylsulfonyl-4-nitrophenyl)piperazine (CAS 1197193-08-0) is a chemical compound with the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. IUPAC name: 1-(3-methylsulfonyl-4-nitrophenyl)piperazine. InChIKey: FHEOTKKERXQVSW-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O4S |
|---|---|
| Molecular weight | 285.32 g/mol |
| IUPAC name | 1-(3-methylsulfonyl-4-nitrophenyl)piperazine |
| InChIKey | FHEOTKKERXQVSW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)N2CCNCC2)[N+](=O)[O-] |
Computed by PubChem (NCBI)