CAS 1158302-05-6 appears in our catalog under these names: N-Methyl-1-[4-(1h-pyrazol-1-yl)phenyl]methanamine sulfate, 95%, N-Methyl-1-(4-(1H-pyrazol-1-yl)phenyl)methanamine hemisulfate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 50g, 1g, 25g, 5g.
N-methyl-1-(4-pyrazol-1-ylphenyl)methanamine;sulfuric acid (CAS 1158302-05-6) is a chemical compound with the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. IUPAC name: N-methyl-1-(4-pyrazol-1-ylphenyl)methanamine;sulfuric acid. InChIKey: ZVPMLJOYIOSOFQ-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O4S |
|---|---|
| Molecular weight | 285.32 g/mol |
| IUPAC name | N-methyl-1-(4-pyrazol-1-ylphenyl)methanamine;sulfuric acid |
| InChIKey | ZVPMLJOYIOSOFQ-UHFFFAOYSA-N |
| SMILES | CNCC1=CC=C(C=C1)N2C=CC=N2.OS(=O)(=O)O |
Computed by PubChem (NCBI)