cas: 1662-21-1 — see every product listed under this CAS number, including other names
N-(4,5-Difluoro-2-nitrophenyl)acetamide, 95%, 95% (CAS 1662-21-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11APIU-1g |
| cas | 1662-21-1 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2277.20 Pln | |
| Chemat | 5g | 8675.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(4,5-difluoro-2-nitrophenyl)acetamide (CAS 1662-21-1) is a chemical compound with the molecular formula C8H6F2N2O3 and a molecular weight of 216.14 g/mol. IUPAC name: N-(4,5-difluoro-2-nitrophenyl)acetamide. InChIKey: OJFQFPPFAFOXAQ-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2O3 |
|---|---|
| Molecular weight | 216.14 g/mol |
| IUPAC name | N-(4,5-difluoro-2-nitrophenyl)acetamide |
| InChIKey | OJFQFPPFAFOXAQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)