N-(4-(1H-1,2,3-Triazol-1-yl)benzyl)-2-(2-isopropylphenyl)-5-methylpyrimidin-4-amine, 98%
cas: 1572414-83-5 — see every product listed under this CAS number, including other names
N-(4-(1H-1,2,3-Triazol-1-yl)benzyl)-2-(2-isopropylphenyl)-5-methylpyrimidin-4-amine, 98% (CAS 1572414-83-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch11ABKT-1mg |
| cas | 1572414-83-5 |
| size | 1mg |
| availability | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 232.40 Pln | |
| Chemat | 5mg | 266.00 Pln | |
| Chemat | 10mg | 419.60 Pln | |
| Chemat | 25mg | 822.80 Pln | |
| Chemat | 50mg | 1312.40 Pln | |
| Chemat | 100mg | 2066.00 Pln | |
| Chemat | 250mg | 3462.80 Pln | |
| Chemat | 1g | 10946.00 Pln | |
| BLDpharm | 25mg | 730.88 Pln | |
| BLDpharm | 50mg | 869.72 Pln | |
| BLDpharm | 100mg | 1291.79 Pln | |
| BLDpharm | 250mg | 3118.93 Pln | |
| BLDpharm | 1g | 9822.12 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-methyl-2-(2-propan-2-ylphenyl)-N-[[4-(triazol-1-yl)phenyl]methyl]pyrimidin-4-amine (CAS 1572414-83-5) is a chemical compound with the molecular formula C23H24N6 and a molecular weight of 384.5 g/mol. IUPAC name: 5-methyl-2-(2-propan-2-ylphenyl)-N-[[4-(triazol-1-yl)phenyl]methyl]pyrimidin-4-amine. InChIKey: VUIRVWPJNKZOSS-UHFFFAOYSA-N.
| Molecular formula | C23H24N6 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | 5-methyl-2-(2-propan-2-ylphenyl)-N-[[4-(triazol-1-yl)phenyl]methyl]pyrimidin-4-amine |
| InChIKey | VUIRVWPJNKZOSS-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(N=C1NCC2=CC=C(C=C2)N3C=CN=N3)C4=CC=CC=C4C(C)C |
Computed by PubChem (NCBI)