CAS 1572414-83-5 appears in our catalog under these names: ML–323, ML-323/ 99.96% (existing batch purity), ML 323, ML-323 98%, N-(4-(1H-1,2,3-Triazol-1-yl)benzyl)-2-(2-isopropylphenyl)-5-methylpyrimidin-4-amine, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 500mg, 250mg.
5-methyl-2-(2-propan-2-ylphenyl)-N-[[4-(triazol-1-yl)phenyl]methyl]pyrimidin-4-amine (CAS 1572414-83-5) is a chemical compound with the molecular formula C23H24N6 and a molecular weight of 384.5 g/mol. IUPAC name: 5-methyl-2-(2-propan-2-ylphenyl)-N-[[4-(triazol-1-yl)phenyl]methyl]pyrimidin-4-amine. InChIKey: VUIRVWPJNKZOSS-UHFFFAOYSA-N.
| Molecular formula | C23H24N6 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | 5-methyl-2-(2-propan-2-ylphenyl)-N-[[4-(triazol-1-yl)phenyl]methyl]pyrimidin-4-amine |
| InChIKey | VUIRVWPJNKZOSS-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(N=C1NCC2=CC=C(C=C2)N3C=CN=N3)C4=CC=CC=C4C(C)C |
Computed by PubChem (NCBI)