cas: 799293-93-9 — see every product listed under this CAS number, including other names
N-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopentanecarboxamide, 95%, 95% (CAS 799293-93-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G9MN-100mg |
| cas | 799293-93-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1734.80 Pln | |
| Chemat | 1g | 6750.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentanecarboxamide (CAS 799293-93-9) is a chemical compound with the molecular formula C18H26BNO3 and a molecular weight of 315.2 g/mol. IUPAC name: N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentanecarboxamide. InChIKey: DKUBMABYGZOVHH-UHFFFAOYSA-N.
| Molecular formula | C18H26BNO3 |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopentanecarboxamide |
| InChIKey | DKUBMABYGZOVHH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)C3CCCC3 |
Computed by PubChem (NCBI)