Products 2490666-08-3
CAS 2490666-08-3 is the registry number for 2-Pentyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
2-pentoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 2490666-08-3) is a chemical compound with the molecular formula C18H26BNO3 and a molecular weight of 315.2 g/mol. IUPAC name: 2-pentoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: JUEFBLHTKLLXIO-UHFFFAOYSA-N.
| Molecular formula | C18H26BNO3 |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | 2-pentoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | JUEFBLHTKLLXIO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C#N)OCCCCC |
Computed by PubChem (NCBI)