cas: 897016-96-5 — see every product listed under this CAS number, including other names
N-(4-Bromo-3-fluorobenzyl)morpholine, 98% (CAS 897016-96-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632400-250MG |
| cas | 897016-96-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 500mg | 393.63 Pln | |
| Fluorochem | 1g | 534.20 Pln | |
| Fluorochem | 5g | 1778.56 Pln | |
| Fluorochem | 10g | 2981.26 Pln | |
| Fluorochem | 25g | 6870.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-[(4-bromo-3-fluorophenyl)methyl]morpholine (CAS 897016-96-5) is a chemical compound with the molecular formula C11H13BrFNO and a molecular weight of 274.13 g/mol. IUPAC name: 4-[(4-bromo-3-fluorophenyl)methyl]morpholine. InChIKey: AXLRZCPFGFYXIS-UHFFFAOYSA-N.
| Molecular formula | C11H13BrFNO |
|---|---|
| Molecular weight | 274.13 g/mol |
| IUPAC name | 4-[(4-bromo-3-fluorophenyl)methyl]morpholine |
| InChIKey | AXLRZCPFGFYXIS-UHFFFAOYSA-N |
| SMILES | C1COCCN1CC2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)