CAS 682778-07-0 is the registry number for 4-Bromo-N,N-diethyl-2-fluorobenzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
4-bromo-N,N-diethyl-2-fluorobenzamide (CAS 682778-07-0) is a chemical compound with the molecular formula C11H13BrFNO and a molecular weight of 274.13 g/mol. IUPAC name: 4-bromo-N,N-diethyl-2-fluorobenzamide. InChIKey: ALFCPMWTMOYQSU-UHFFFAOYSA-N.
| Molecular formula | C11H13BrFNO |
|---|---|
| Molecular weight | 274.13 g/mol |
| IUPAC name | 4-bromo-N,N-diethyl-2-fluorobenzamide |
| InChIKey | ALFCPMWTMOYQSU-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)