cas: 90914-81-1 — see every product listed under this CAS number, including other names
N-(4-Bromo-3-methylphenyl)acetamide (CAS 90914-81-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211324-1G |
| cas | 90914-81-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 25g | 445.69 Pln | |
| Fluorochem | 100g | 1539.06 Pln | |
| Fluorochem | 500g | 4881.63 Pln |
| delivery time | 3-4 weeks |
|---|
N-(4-bromo-3-methylphenyl)acetamide (CAS 90914-81-1) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: N-(4-bromo-3-methylphenyl)acetamide. InChIKey: BYZHUFNLXFFINU-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | N-(4-bromo-3-methylphenyl)acetamide |
| InChIKey | BYZHUFNLXFFINU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)C)Br |
Computed by PubChem (NCBI)