CAS 90914-81-1 appears in our catalog under these names: N-Acetyl 4-Bromo-3-methylaniline, 96%, 4'–Bromo–3'–methylacetanilide, 4'-Bromo-3'-methylacetanilide, >98.0%(GC), N-(4-Bromo-3-methylphenyl)acetamide, 96%, 96%, N-(4-Bromo-3-methylphenyl)acetamide. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 500g, 25g, 5g, 1g, 10g.
N-(4-bromo-3-methylphenyl)acetamide (CAS 90914-81-1) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: N-(4-bromo-3-methylphenyl)acetamide. InChIKey: BYZHUFNLXFFINU-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | N-(4-bromo-3-methylphenyl)acetamide |
| InChIKey | BYZHUFNLXFFINU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)C)Br |
Computed by PubChem (NCBI)