cas: 14547-73-0 — see every product listed under this CAS number, including other names
N-(4-Bromophenyl)picolinamide 95+% (CAS 14547-73-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A871081-1g |
| cas | 14547-73-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1277.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A871081 |
N-(4-bromophenyl)pyridine-2-carboxamide (CAS 14547-73-0) is a chemical compound with the molecular formula C12H9BrN2O and a molecular weight of 277.12 g/mol. IUPAC name: N-(4-bromophenyl)pyridine-2-carboxamide. InChIKey: RAJKUZRIZUSGKU-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O |
|---|---|
| Molecular weight | 277.12 g/mol |
| IUPAC name | N-(4-bromophenyl)pyridine-2-carboxamide |
| InChIKey | RAJKUZRIZUSGKU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)