cas: 1266384-47-7 — see every product listed under this CAS number, including other names
N-(4-Chloro-3-methylphenyl)-4-methyl-benzenesulfonamide 95% (CAS 1266384-47-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A984780-1g |
| cas | 1266384-47-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 960.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A984780 |
N-(4-chloro-3-methylphenyl)-4-methylbenzenesulfonamide (CAS 1266384-47-7) is a chemical compound with the molecular formula C14H14ClNO2S and a molecular weight of 295.8 g/mol. IUPAC name: N-(4-chloro-3-methylphenyl)-4-methylbenzenesulfonamide. InChIKey: HLJMGFQSTPBMGL-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2S |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | N-(4-chloro-3-methylphenyl)-4-methylbenzenesulfonamide |
| InChIKey | HLJMGFQSTPBMGL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C=C2)Cl)C |
Computed by PubChem (NCBI)