cas: 122987-01-3 — see every product listed under this CAS number, including other names
N-(4-Chlorophenyl)-2,6-difluorobenzamide 95+% (CAS 122987-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A920016-100mg |
| cas | 122987-01-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 932.19 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A920016 |
N-(4-chlorophenyl)-2,6-difluorobenzamide (CAS 122987-01-3) is a chemical compound with the molecular formula C13H8ClF2NO and a molecular weight of 267.66 g/mol. IUPAC name: N-(4-chlorophenyl)-2,6-difluorobenzamide. InChIKey: BBRYXEGYUUQZIT-UHFFFAOYSA-N.
| Molecular formula | C13H8ClF2NO |
|---|---|
| Molecular weight | 267.66 g/mol |
| IUPAC name | N-(4-chlorophenyl)-2,6-difluorobenzamide |
| InChIKey | BBRYXEGYUUQZIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)NC2=CC=C(C=C2)Cl)F |
Computed by PubChem (NCBI)