cas: 122987-01-3 — see every product listed under this CAS number, including other names
N-(4-Chlorophenyl)-2,6-difluorobenzamide, 95%, 95% (CAS 122987-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111JV1-100mg |
| cas | 122987-01-3 |
| size | 100mg |
| availability | 1.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 477.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(4-chlorophenyl)-2,6-difluorobenzamide (CAS 122987-01-3) is a chemical compound with the molecular formula C13H8ClF2NO and a molecular weight of 267.66 g/mol. IUPAC name: N-(4-chlorophenyl)-2,6-difluorobenzamide. InChIKey: BBRYXEGYUUQZIT-UHFFFAOYSA-N.
| Molecular formula | C13H8ClF2NO |
|---|---|
| Molecular weight | 267.66 g/mol |
| IUPAC name | N-(4-chlorophenyl)-2,6-difluorobenzamide |
| InChIKey | BBRYXEGYUUQZIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)NC2=CC=C(C=C2)Cl)F |
Computed by PubChem (NCBI)