cas: 329939-43-7 — see every product listed under this CAS number, including other names
N-(4-Methoxybenzyl) 4-bromobenzenesulfonamide, 98%, 98% (CAS 329939-43-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C1YF-1g |
| cas | 329939-43-7 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 486.80 Pln | |
| Chemat | 5g | 1346.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-N-[(4-methoxyphenyl)methyl]benzenesulfonamide (CAS 329939-43-7) is a chemical compound with the molecular formula C14H14BrNO3S and a molecular weight of 356.24 g/mol. IUPAC name: 4-bromo-N-[(4-methoxyphenyl)methyl]benzenesulfonamide. InChIKey: HKTIXZGUJGCYDO-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO3S |
|---|---|
| Molecular weight | 356.24 g/mol |
| IUPAC name | 4-bromo-N-[(4-methoxyphenyl)methyl]benzenesulfonamide |
| InChIKey | HKTIXZGUJGCYDO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNS(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)