CAS 446308-82-3 is the registry number for N-Benzyl 5-bromo-2-methoxybenzenesulfonamide, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
N-benzyl-5-bromo-2-methoxybenzenesulfonamide (CAS 446308-82-3) is a chemical compound with the molecular formula C14H14BrNO3S and a molecular weight of 356.24 g/mol. IUPAC name: N-benzyl-5-bromo-2-methoxybenzenesulfonamide. InChIKey: AJCKWNSXFRBQSE-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO3S |
|---|---|
| Molecular weight | 356.24 g/mol |
| IUPAC name | N-benzyl-5-bromo-2-methoxybenzenesulfonamide |
| InChIKey | AJCKWNSXFRBQSE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)S(=O)(=O)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)