cas: 63893-95-8 — see every product listed under this CAS number, including other names
N-(4-Methoxybenzyl)thieno[2,3-d]pyrimidin-4-amine 98% (CAS 63893-95-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A716999-100mg |
| cas | 63893-95-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 281.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A716999 |
N-[(4-methoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine (CAS 63893-95-8) is a chemical compound with the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. IUPAC name: N-[(4-methoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine. InChIKey: FJGLKCHDKKGMDH-UHFFFAOYSA-N.
| Molecular formula | C14H13N3OS |
|---|---|
| Molecular weight | 271.34 g/mol |
| IUPAC name | N-[(4-methoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| InChIKey | FJGLKCHDKKGMDH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC2=C3C=CSC3=NC=N2 |
Computed by PubChem (NCBI)