cas: 433704-82-6 — see every product listed under this CAS number, including other names
N-(4-Methoxyphenethyl)-1-(2-methylbenzoyl)piperidine-4-carboxamide, ≥98%, ≥98% (CAS 433704-82-6) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch134PTJ-5mg |
| cas | 433704-82-6 |
| size | 5mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 822.80 Pln | |
| Chemat | 25mg | 2498.00 Pln | |
| Chemat | 50mg | 3875.60 Pln | |
| Chemat | 100mg | 6554.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
N-[2-(4-methoxyphenyl)ethyl]-1-(2-methylbenzoyl)piperidine-4-carboxamide (CAS 433704-82-6) is a chemical compound with the molecular formula C23H28N2O3 and a molecular weight of 380.5 g/mol. IUPAC name: N-[2-(4-methoxyphenyl)ethyl]-1-(2-methylbenzoyl)piperidine-4-carboxamide. InChIKey: UTSUBQVCTPCCQF-UHFFFAOYSA-N.
| Molecular formula | C23H28N2O3 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | N-[2-(4-methoxyphenyl)ethyl]-1-(2-methylbenzoyl)piperidine-4-carboxamide |
| InChIKey | UTSUBQVCTPCCQF-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)N2CCC(CC2)C(=O)NCCC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)