Products 75690-74-3

CAS 75690-74-3 is the registry number for N-Cyclohexyl DL-Z-Phenylalaninamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 75690-74-3) is a chemical compound with the molecular formula C23H28N2O3 and a molecular weight of 380.5 g/mol. IUPAC name: benzyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: JNOPAYROMBBZSP-UHFFFAOYSA-N.

Identity
Molecular formulaC23H28N2O3
Molecular weight380.5 g/mol
IUPAC namebenzyl N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]carbamate
InChIKeyJNOPAYROMBBZSP-UHFFFAOYSA-N
SMILESC1CCC(CC1)NC(=O)C(CC2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)