cas: 127472-35-9 — see every product listed under this CAS number, including other names
N-(4-chloro-2-formylphenyl)-2,2-dimethylpropionamide (CAS 127472-35-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631957-1G |
| cas | 127472-35-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1278.73 Pln | |
| Fluorochem | 5g | 3689.34 Pln |
| delivery time | 3-4 weeks |
|---|
N-(4-chloro-2-formylphenyl)-2,2-dimethylpropanamide (CAS 127472-35-9) is a chemical compound with the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. IUPAC name: N-(4-chloro-2-formylphenyl)-2,2-dimethylpropanamide. InChIKey: GKJGOJHGTYDZPP-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO2 |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | N-(4-chloro-2-formylphenyl)-2,2-dimethylpropanamide |
| InChIKey | GKJGOJHGTYDZPP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=C(C=C1)Cl)C=O |
Computed by PubChem (NCBI)