cas: 50878-03-0 — see every product listed under this CAS number, including other names
N-(5,6,7,8-Tetrahydronaphthalen-2-yl)acetamide, 97%, 97% (CAS 50878-03-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D0UB-100mg |
| cas | 50878-03-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 602.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide (CAS 50878-03-0) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: N-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide. InChIKey: QJEVQGGWBHGIBZ-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | N-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
| InChIKey | QJEVQGGWBHGIBZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC2=C(CCCC2)C=C1 |
Computed by PubChem (NCBI)