cas: 1158592-05-2 — see every product listed under this CAS number, including other names
N-(5-Chloro-2-methoxybenzyl)ethanamine hydrochloride 98% (CAS 1158592-05-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1715037-100mg |
| cas | 1158592-05-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 453.81 Pln | |
| Ambeed | 250mg | 687.44 Pln | |
| Ambeed | 1g | 1822.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1715037 |
N-[(5-chloro-2-methoxyphenyl)methyl]ethanamine;hydrochloride (CAS 1158592-05-2) is a chemical compound with the molecular formula C10H15Cl2NO and a molecular weight of 236.13 g/mol. IUPAC name: N-[(5-chloro-2-methoxyphenyl)methyl]ethanamine;hydrochloride. InChIKey: OUQAOPWHLDUQAM-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2NO |
|---|---|
| Molecular weight | 236.13 g/mol |
| IUPAC name | N-[(5-chloro-2-methoxyphenyl)methyl]ethanamine;hydrochloride |
| InChIKey | OUQAOPWHLDUQAM-UHFFFAOYSA-N |
| SMILES | CCNCC1=C(C=CC(=C1)Cl)OC.Cl |
Computed by PubChem (NCBI)