Products 1052076-92-2

CAS 1052076-92-2 is the registry number for 4-(4-Chlorophenoxy)butan-1-amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-(4-chlorophenoxy)butan-1-amine;hydrochloride (CAS 1052076-92-2) is a chemical compound with the molecular formula C10H15Cl2NO and a molecular weight of 236.13 g/mol. IUPAC name: 4-(4-chlorophenoxy)butan-1-amine;hydrochloride. InChIKey: OJDFCZRYNHCCMV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15Cl2NO
Molecular weight236.13 g/mol
IUPAC name4-(4-chlorophenoxy)butan-1-amine;hydrochloride
InChIKeyOJDFCZRYNHCCMV-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1OCCCCN)Cl.Cl

Computed by PubChem (NCBI)