cas: 1328360-41-3 — see every product listed under this CAS number, including other names
N-(6-BROMO-3-PYRIDYL)METHANESULFONAMIDE, 97% (CAS 1328360-41-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F822848-1G |
| cas | 1328360-41-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 502.97 Pln | |
| Fluorochem | 5g | 1372.45 Pln | |
| Fluorochem | 10g | 2294.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-(6-bromo-3-pyridinyl)methanesulfonamide (CAS 1328360-41-3) is a chemical compound with the molecular formula C6H7BrN2O2S and a molecular weight of 251.10 g/mol. IUPAC name: N-(6-bromo-3-pyridinyl)methanesulfonamide. InChIKey: GVIOYWCQXGRYBK-UHFFFAOYSA-N.
| Molecular formula | C6H7BrN2O2S |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | N-(6-bromo-3-pyridinyl)methanesulfonamide |
| InChIKey | GVIOYWCQXGRYBK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CN=C(C=C1)Br |
Computed by PubChem (NCBI)