cas: 86847-79-2 — see every product listed under this CAS number, including other names
N-(6-Methylpyridin-2-yl)pivalamide, 98%, 98% (CAS 86847-79-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115QWF-100mg |
| cas | 86847-79-2 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 309.20 Pln | |
| Chemat | 25g | 587.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,2-dimethyl-N-(6-methyl-2-pyridinyl)propanamide (CAS 86847-79-2) is a chemical compound with the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. IUPAC name: 2,2-dimethyl-N-(6-methyl-2-pyridinyl)propanamide. InChIKey: MAZMJMLUKYPLEI-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 2,2-dimethyl-N-(6-methyl-2-pyridinyl)propanamide |
| InChIKey | MAZMJMLUKYPLEI-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)