N-(Benzyloxycarbonyl)-L-alanyl-L-alanine methyl ester, 97%, 97%
cas: 2483-51-4 — see every product listed under this CAS number, including other names
N-(Benzyloxycarbonyl)-L-alanyl-L-alanine methyl ester, 97%, 97% (CAS 2483-51-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C2HH-1g |
| cas | 2483-51-4 |
| size | 1g |
| availability | 75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 227.60 Pln | |
| Chemat | 25g | 405.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate (CAS 2483-51-4) is a chemical compound with the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. IUPAC name: methyl (2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate. InChIKey: CUCAZZQPISJXOS-QWRGUYRKSA-N.
| Molecular formula | C15H20N2O5 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | methyl (2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate |
| InChIKey | CUCAZZQPISJXOS-QWRGUYRKSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)OC)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
N-[(Phenylmethoxy)carbonyl]-L-alanyl-L-alanine methyl ester, N-((Phenylmethoxy)carbonyl)-L-alanyl-L-alanine methyl ester, Cbz-Ala-Ala-Ome, Z-Ala-Ala-OMe, N-(Benzyloxycarbonyl)-L-alanyl-L-alanine methyl ester, methyl (2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate, Cbz-L-Ala-Ala-Ome, Z-L-ALANYL-L-ALANINE METHYL ESTER, Cbz-L-Ala-L-Ala-OMe, Cbz-L-Ala-Ala-Ome-OH