CAS 2790-84-3 appears in our catalog under these names: Z-Val-gly-oh, 98%, Z–Val–Gly–OH, Z-Val-Gly-OH, 98%, 98%, Z-Val-Gly-OH, 99.12%, Z-L-valyl-L-glycine, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 100g, 10g, 25g, 1 g, 10 g.
2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetic acid (CAS 2790-84-3) is a chemical compound with the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. IUPAC name: 2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetic acid. InChIKey: MWOJWUBBCZRMTB-ZDUSSCGKSA-N.
| Molecular formula | C15H20N2O5 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetic acid |
| InChIKey | MWOJWUBBCZRMTB-ZDUSSCGKSA-N |
| SMILES | CC(C)[C@@H](C(=O)NCC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)